C17H20F3N3O4 — CID 146469098
[2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(4,4,4-trifluorobutoxy)phenyl]propyl] carbamate (PubChem CID 146469098) has the molecular formula C17H20F3N3O4 and a molecular weight of 387.36 g/mol. Its IUPAC name is [2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(4,4,4-trifluorobutoxy)phenyl]propyl] carbamate.
| Compound Name | [2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(4,4,4-trifluorobutoxy)phenyl]propyl] carbamate |
|---|---|
| PubChem CID | 146469098 |
| Molecular Formula | C17H20F3N3O4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(4,4,4-trifluorobutoxy)phenyl]propyl] carbamate |
| SMILES | Cc1nnc(C(C)C(OC(N)=O)c2cccc(OCCCC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C17H20F3N3O4/c1-10(15-23-22-11(2)26-15)14(27-16(21)24)12-5-3-6-13(9-12)25-8-4-7-17(18,19)20/h3,5-6,9-10,14H,4,7-8H2,1-2H3,(H2,21,24) |
| InChIKey | IXOLEGJOYWFJHE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|