C14H14F4N2O3 — CID 146469141
2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanol (PubChem CID 146469141) has the molecular formula C14H14F4N2O3 and a molecular weight of 334.27 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanol.
| Compound Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 146469141 |
| Molecular Formula | C14H14F4N2O3 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[3-(2,2,3,3-tetrafluoropropoxy)phenyl]ethanol |
| SMILES | Cc1nnc(CC(O)c2cccc(OCC(F)(F)C(F)F)c2)o1 |
| InChI | InChI=1S/C14H14F4N2O3/c1-8-19-20-12(23-8)6-11(21)9-3-2-4-10(5-9)22-7-14(17,18)13(15)16/h2-5,11,13,21H,6-7H2,1H3 |
| InChIKey | MYBPYPWJCHGCEB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|