C16H26O3 — CID 69097533
3-[[3-[(1R)-1-hydroxybutyl]phenoxy]methyl]pentan-3-ol (PubChem CID 69097533) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-[[3-[(1R)-1-hydroxybutyl]phenoxy]methyl]pentan-3-ol.
| Compound Name | 3-[[3-[(1R)-1-hydroxybutyl]phenoxy]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 69097533 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 3-[[3-[(1R)-1-hydroxybutyl]phenoxy]methyl]pentan-3-ol |
| SMILES | CCC[C@@H](O)c1cccc(OCC(O)(CC)CC)c1 |
| InChI | InChI=1S/C16H26O3/c1-4-8-15(17)13-9-7-10-14(11-13)19-12-16(18,5-2)6-3/h7,9-11,15,17-18H,4-6,8,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | NDGUXQOVJMPOQC-OAHLLOKOSA-N |
| XLogP | 3.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |