C18H31NO3 — CID 170002029
3-amino-1-[3-(2-methoxy-2-propylpentoxy)phenyl]propan-1-ol (PubChem CID 170002029) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-amino-1-[3-(2-methoxy-2-propylpentoxy)phenyl]propan-1-ol.
| Compound Name | 3-amino-1-[3-(2-methoxy-2-propylpentoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 170002029 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 3-amino-1-[3-(2-methoxy-2-propylpentoxy)phenyl]propan-1-ol |
| SMILES | CCCC(CCC)(COc1cccc(C(O)CCN)c1)OC |
| InChI | InChI=1S/C18H31NO3/c1-4-10-18(21-3,11-5-2)14-22-16-8-6-7-15(13-16)17(20)9-12-19/h6-8,13,17,20H,4-5,9-12,14,19H2,1-3H3 |
| InChIKey | CDFNTNVPQMAJHB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |