C18H22ClNO2 — CID 130373215
3-amino-1-[3-[(2-chloro-6-ethylphenyl)methoxy]phenyl]propan-1-ol (PubChem CID 130373215) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 3-amino-1-[3-[(2-chloro-6-ethylphenyl)methoxy]phenyl]propan-1-ol.
| Compound Name | 3-amino-1-[3-[(2-chloro-6-ethylphenyl)methoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 130373215 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-amino-1-[3-[(2-chloro-6-ethylphenyl)methoxy]phenyl]propan-1-ol |
| SMILES | CCc1cccc(Cl)c1COc1cccc(C(O)CCN)c1 |
| InChI | InChI=1S/C18H22ClNO2/c1-2-13-5-4-8-17(19)16(13)12-22-15-7-3-6-14(11-15)18(21)9-10-20/h3-8,11,18,21H,2,9-10,12,20H2,1H3 |
| InChIKey | MPFKCLPULVDBPS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |