C14H24N2O3 — CID 143786000
4-[3-(3-amino-1-hydroxypropyl)phenoxy]butanal;methanamine (PubChem CID 143786000) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[3-(3-amino-1-hydroxypropyl)phenoxy]butanal;methanamine.
| Compound Name | 4-[3-(3-amino-1-hydroxypropyl)phenoxy]butanal;methanamine |
|---|---|
| PubChem CID | 143786000 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 4-[3-(3-amino-1-hydroxypropyl)phenoxy]butanal;methanamine |
| SMILES | CN.NCCC(O)c1cccc(OCCCC=O)c1 |
| InChI | InChI=1S/C13H19NO3.CH5N/c14-7-6-13(16)11-4-3-5-12(10-11)17-9-2-1-8-15;1-2/h3-5,8,10,13,16H,1-2,6-7,9,14H2;2H2,1H3 |
| InChIKey | HKGOXFUQZMTGJC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|