C14H23BN2O4 — CID 69097575
N-[3-[3-(4-amino-4-oxobutoxy)phenyl]-3-hydroxypropyl]-methylboronamidic acid (PubChem CID 69097575) has the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. Its IUPAC name is N-[3-[3-(4-amino-4-oxobutoxy)phenyl]-3-hydroxypropyl]-methylboronamidic acid.
| Compound Name | N-[3-[3-(4-amino-4-oxobutoxy)phenyl]-3-hydroxypropyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 69097575 |
| Molecular Formula | C14H23BN2O4 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N-[3-[3-(4-amino-4-oxobutoxy)phenyl]-3-hydroxypropyl]-methylboronamidic acid |
| SMILES | CB(O)NCCC(O)c1cccc(OCCCC(N)=O)c1 |
| InChI | InChI=1S/C14H23BN2O4/c1-15(20)17-8-7-13(18)11-4-2-5-12(10-11)21-9-3-6-14(16)19/h2,4-5,10,13,17-18,20H,3,6-9H2,1H3,(H2,16,19) |
| InChIKey | ONDWDOYAXXXXHB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|