C16H25BNO5 — CID 71018487
CID 71018487 (PubChem CID 71018487) has the molecular formula C16H25BNO5 and a molecular weight of 322.19 g/mol.
| Compound Name | CID 71018487 |
|---|---|
| PubChem CID | 71018487 |
| Molecular Formula | C16H25BNO5 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | — |
| SMILES | CCOC(=O)CCCOc1cccc(C(O)CCN[B]OC)c1 |
| InChI | InChI=1S/C16H25BNO5/c1-3-22-16(20)8-5-11-23-14-7-4-6-13(12-14)15(19)9-10-18-17-21-2/h4,6-7,12,15,18-19H,3,5,8-11H2,1-2H3 |
| InChIKey | FKQQOFSKBBSQNJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|