C22H35NO5 — CID 164593056
ethyl 7-[3-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]heptanoate (PubChem CID 164593056) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is ethyl 7-[3-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]heptanoate.
| Compound Name | ethyl 7-[3-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]heptanoate |
|---|---|
| PubChem CID | 164593056 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | ethyl 7-[3-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]heptanoate |
| SMILES | CCOC(=O)CCCCCCOc1cccc([C@@H](C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H35NO5/c1-6-26-20(24)14-9-7-8-10-15-27-19-13-11-12-18(16-19)17(2)23-21(25)28-22(3,4)5/h11-13,16-17H,6-10,14-15H2,1-5H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | ZYFHNOOZVXEKHN-QGZVFWFLSA-N |
| XLogP | 5.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|