C25H33ClN2O5 — CID 69353407
ethyl 4-[4-chloro-2-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]anilino]butanoate (PubChem CID 69353407) has the molecular formula C25H33ClN2O5 and a molecular weight of 477.00 g/mol. Its IUPAC name is ethyl 4-[4-chloro-2-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]anilino]butanoate.
| Compound Name | ethyl 4-[4-chloro-2-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]anilino]butanoate |
|---|---|
| PubChem CID | 69353407 |
| Molecular Formula | C25H33ClN2O5 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | ethyl 4-[4-chloro-2-[3-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenoxy]anilino]butanoate |
| SMILES | CCOC(=O)CCCNc1ccc(Cl)cc1Oc1cccc([C@H](C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H33ClN2O5/c1-6-31-23(29)11-8-14-27-21-13-12-19(26)16-22(21)32-20-10-7-9-18(15-20)17(2)28-24(30)33-25(3,4)5/h7,9-10,12-13,15-17,27H,6,8,11,14H2,1-5H3,(H,28,30)/t17-/m0/s1 |
| InChIKey | SFFFBAIEJGTFFH-KRWDZBQOSA-N |
| XLogP | 6.47 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|