C21H35NO3 — CID 71018431
N-[3-hydroxy-3-[3-(2-methyl-2-propylpentoxy)phenyl]propyl]-N-methylacetamide (PubChem CID 71018431) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is N-[3-hydroxy-3-[3-(2-methyl-2-propylpentoxy)phenyl]propyl]-N-methylacetamide.
| Compound Name | N-[3-hydroxy-3-[3-(2-methyl-2-propylpentoxy)phenyl]propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 71018431 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | N-[3-hydroxy-3-[3-(2-methyl-2-propylpentoxy)phenyl]propyl]-N-methylacetamide |
| SMILES | CCCC(C)(CCC)COc1cccc(C(O)CCN(C)C(C)=O)c1 |
| InChI | InChI=1S/C21H35NO3/c1-6-12-21(4,13-7-2)16-25-19-10-8-9-18(15-19)20(24)11-14-22(5)17(3)23/h8-10,15,20,24H,6-7,11-14,16H2,1-5H3 |
| InChIKey | LRZQBMAOCVAJIK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |