C33H44F3N3O8 — CID 146469577
[1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate (PubChem CID 146469577) has the molecular formula C33H44F3N3O8 and a molecular weight of 667.72 g/mol. Its IUPAC name is [1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate.
| Compound Name | [1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 146469577 |
| Molecular Formula | C33H44F3N3O8 |
| Molecular Weight | 667.72 g/mol |
| Exact Mass | 667.31 |
| IUPAC Name | [1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
| SMILES | COCCCC/C(=N\OCCNC(=O)OC(OC(=O)C(NC(=O)OC(C)(C)C)c1ccccc1)C(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H44F3N3O8/c1-22(2)29(45-28(40)27(24-12-8-7-9-13-24)38-31(42)47-32(3,4)5)46-30(41)37-19-21-44-39-26(14-10-11-20-43-6)23-15-17-25(18-16-23)33(34,35)36/h7-9,12-13,15-18,22,27,29H,10-11,14,19-21H2,1-6H3,(H,37,41)(H,38,42)/b39-26+ |
| InChIKey | WEWYFNUBRBDWTN-JBFMKSPFSA-N |
| XLogP | 6.76 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|