C30H37F6N3O8 — CID 146469578
[1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-amino-2-phenylacetate;2,2,2-trifluoroacetic acid (PubChem CID 146469578) has the molecular formula C30H37F6N3O8 and a molecular weight of 681.63 g/mol. Its IUPAC name is [1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-amino-2-phenylacetate;2,2,2-trifluoroacetic acid.
| Compound Name | [1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-amino-2-phenylacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146469578 |
| Molecular Formula | C30H37F6N3O8 |
| Molecular Weight | 681.63 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | [1-[2-[(E)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethylcarbamoyloxy]-2-methylpropyl] 2-amino-2-phenylacetate;2,2,2-trifluoroacetic acid |
| SMILES | COCCCC/C(=N\OCCNC(=O)OC(OC(=O)C(N)c1ccccc1)C(C)C)c1ccc(C(F)(F)F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H36F3N3O6.C2HF3O2/c1-19(2)26(39-25(35)24(32)21-9-5-4-6-10-21)40-27(36)33-16-18-38-34-23(11-7-8-17-37-3)20-12-14-22(15-13-20)28(29,30)31;3-2(4,5)1(6)7/h4-6,9-10,12-15,19,24,26H,7-8,11,16-18,32H2,1-3H3,(H,33,36);(H,6,7)/b34-23+; |
| InChIKey | HOJUZRDUDBJNQI-ABYLTVOZSA-N |
| XLogP | 5.83 |
| TPSA | 158.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|