C26H37N3O4 — CID 88567863
[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[2-[(E)-[5-methoxy-1-(4-methylphenyl)pentylidene]amino]oxyethyl]carbamate (PubChem CID 88567863) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[2-[(E)-[5-methoxy-1-(4-methylphenyl)pentylidene]amino]oxyethyl]carbamate.
| Compound Name | [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[2-[(E)-[5-methoxy-1-(4-methylphenyl)pentylidene]amino]oxyethyl]carbamate |
|---|---|
| PubChem CID | 88567863 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-[2-[(E)-[5-methoxy-1-(4-methylphenyl)pentylidene]amino]oxyethyl]carbamate |
| SMILES | COCCCC/C(=N\OCCNC(=O)Oc1cccc([C@H](C)N(C)C)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H37N3O4/c1-20-12-14-22(15-13-20)25(11-6-7-17-31-5)28-32-18-16-27-26(30)33-24-10-8-9-23(19-24)21(2)29(3)4/h8-10,12-15,19,21H,6-7,11,16-18H2,1-5H3,(H,27,30)/b28-25+/t21-/m0/s1 |
| InChIKey | BSAXEGOIFRTYGR-JLGRXMNQSA-N |
| XLogP | 4.94 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|