C7H6BrClF3NS2 — CID 146476592
2-(4-bromo-3-chloro-3,4,4-trifluorobutyl)sulfanyl-1,3-thiazole (PubChem CID 146476592) has the molecular formula C7H6BrClF3NS2 and a molecular weight of 340.62 g/mol. Its IUPAC name is 2-(4-bromo-3-chloro-3,4,4-trifluorobutyl)sulfanyl-1,3-thiazole.
| Compound Name | 2-(4-bromo-3-chloro-3,4,4-trifluorobutyl)sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 146476592 |
| Molecular Formula | C7H6BrClF3NS2 |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 338.88 |
| IUPAC Name | 2-(4-bromo-3-chloro-3,4,4-trifluorobutyl)sulfanyl-1,3-thiazole |
| SMILES | FC(F)(Br)C(F)(Cl)CCSc1nccs1 |
| InChI | InChI=1S/C7H6BrClF3NS2/c8-7(11,12)6(9,10)1-3-14-5-13-2-4-15-5/h2,4H,1,3H2 |
| InChIKey | XHNNCKXUVRDMOS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|