C58H46N2O2P2 — CID 146477878
2-bis(3-phenylphenyl)phosphoryl-6-[6-[[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-(3-phenylphenyl)phosphoryl]-2-pyridinyl]pyridine (PubChem CID 146477878) has the molecular formula C58H46N2O2P2 and a molecular weight of 864.97 g/mol. Its IUPAC name is 2-bis(3-phenylphenyl)phosphoryl-6-[6-[[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-(3-phenylphenyl)phosphoryl]-2-pyridinyl]pyridine.
| Compound Name | 2-bis(3-phenylphenyl)phosphoryl-6-[6-[[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-(3-phenylphenyl)phosphoryl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 146477878 |
| Molecular Formula | C58H46N2O2P2 |
| Molecular Weight | 864.97 g/mol |
| Exact Mass | 864.30 |
| IUPAC Name | 2-bis(3-phenylphenyl)phosphoryl-6-[6-[[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-(3-phenylphenyl)phosphoryl]-2-pyridinyl]pyridine |
| SMILES | C/C=C(\C=C(/C)c1ccccc1)P(=O)(c1cccc(-c2ccccc2)c1)c1cccc(-c2cccc(P(=O)(c3cccc(-c4ccccc4)c3)c3cccc(-c4ccccc4)c3)n2)n1 |
| InChI | InChI=1S/C58H46N2O2P2/c1-3-51(39-43(2)44-21-8-4-9-22-44)63(61,52-32-16-29-48(40-52)45-23-10-5-11-24-45)57-37-19-35-55(59-57)56-36-20-38-58(60-56)64(62,53-33-17-30-49(41-53)46-25-12-6-13-26-46)54-34-18-31-50(42-54)47-27-14-7-15-28-47/h3-42H,1-2H3/b43-39+,51-3+ |
| InChIKey | VENFPMGVOCLDGR-UKNZXDSQSA-N |
| XLogP | 13.11 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.97 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|