C40H38N2+2 — CID 2306810
1-methyl-4-[4-(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)butyl]-2,6-diphenylpyridin-1-ium (PubChem CID 2306810) has the molecular formula C40H38N2+2 and a molecular weight of 546.76 g/mol. Its IUPAC name is 1-methyl-4-[4-(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)butyl]-2,6-diphenylpyridin-1-ium.
| Compound Name | 1-methyl-4-[4-(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)butyl]-2,6-diphenylpyridin-1-ium |
|---|---|
| PubChem CID | 2306810 |
| Molecular Formula | C40H38N2+2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 1-methyl-4-[4-(1-methyl-2,6-diphenylpyridin-1-ium-4-yl)butyl]-2,6-diphenylpyridin-1-ium |
| SMILES | C[n+]1c(-c2ccccc2)cc(CCCCc2cc(-c3ccccc3)[n+](C)c(-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C40H38N2/c1-41-37(33-19-7-3-8-20-33)27-31(28-38(41)34-21-9-4-10-22-34)17-15-16-18-32-29-39(35-23-11-5-12-24-35)42(2)40(30-32)36-25-13-6-14-26-36/h3-14,19-30H,15-18H2,1-2H3/q+2 |
| InChIKey | FXCDWSMBGCLNKT-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|