C36H41Cl2N9O3 — CID 146478043
3-butan-2-yl-1-[6-[4-[4-[[2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-4H-pyrimidin-2-imine (PubChem CID 146478043) has the molecular formula C36H41Cl2N9O3 and a molecular weight of 718.69 g/mol. Its IUPAC name is 3-butan-2-yl-1-[6-[4-[4-[[2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-4H-pyrimidin-2-imine.
| Compound Name | 3-butan-2-yl-1-[6-[4-[4-[[2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-4H-pyrimidin-2-imine |
|---|---|
| PubChem CID | 146478043 |
| Molecular Formula | C36H41Cl2N9O3 |
| Molecular Weight | 718.69 g/mol |
| Exact Mass | 717.27 |
| IUPAC Name | 3-butan-2-yl-1-[6-[4-[4-[[2-(2,4-dichlorophenyl)-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-4H-pyrimidin-2-imine |
| SMILES | [H]/N=C1/N(c2ccc(N3CCN(c4ccc(OCC5COC(Cn6nccn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)nc2)C=CCN1C(C)CC |
| InChI | InChI=1S/C36H41Cl2N9O3/c1-3-26(2)45-15-4-16-46(35(45)39)29-8-12-34(40-22-29)44-19-17-43(18-20-44)28-6-9-30(10-7-28)48-23-31-24-49-36(50-31,25-47-41-13-14-42-47)32-11-5-27(37)21-33(32)38/h4-14,16,21-22,26,31,39H,3,15,17-20,23-25H2,1-2H3/b39-35+ |
| InChIKey | KINOBHXZPHFRIQ-IGIMMJHKSA-N |
| XLogP | 6.02 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|