C33H28S2 — CID 146480049
2-[(E,6E)-6-cyclohexa-2,4-dien-1-ylidene-2-prop-1-en-2-ylsulfanylhex-1-enyl]-3-ethynylnaphtho[2,3-b][1]benzothiole (PubChem CID 146480049) has the molecular formula C33H28S2 and a molecular weight of 488.72 g/mol. Its IUPAC name is 2-[(E,6E)-6-cyclohexa-2,4-dien-1-ylidene-2-prop-1-en-2-ylsulfanylhex-1-enyl]-3-ethynylnaphtho[2,3-b][1]benzothiole.
| Compound Name | 2-[(E,6E)-6-cyclohexa-2,4-dien-1-ylidene-2-prop-1-en-2-ylsulfanylhex-1-enyl]-3-ethynylnaphtho[2,3-b][1]benzothiole |
|---|---|
| PubChem CID | 146480049 |
| Molecular Formula | C33H28S2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-[(E,6E)-6-cyclohexa-2,4-dien-1-ylidene-2-prop-1-en-2-ylsulfanylhex-1-enyl]-3-ethynylnaphtho[2,3-b][1]benzothiole |
| SMILES | C#Cc1cc2sc3cc4ccccc4cc3c2cc1/C=C(\CCC/C=C1/C=CC=CC1)SC(=C)C |
| InChI | InChI=1S/C33H28S2/c1-4-25-21-32-31(30-19-26-15-9-10-16-27(26)22-33(30)35-32)20-28(25)18-29(34-23(2)3)17-11-8-14-24-12-6-5-7-13-24/h1,5-7,9-10,12,14-16,18-22H,2,8,11,13,17H2,3H3/b24-14-,29-18+ |
| InChIKey | WHPUJYPHBDKFAQ-OBJUMUEESA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|