C44H37N3 — CID 118123931
2-[(3Z,5E)-5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-yl]-4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazine (PubChem CID 118123931) has the molecular formula C44H37N3 and a molecular weight of 607.80 g/mol. Its IUPAC name is 2-[(3Z,5E)-5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-yl]-4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazine.
| Compound Name | 2-[(3Z,5E)-5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-yl]-4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118123931 |
| Molecular Formula | C44H37N3 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 2-[(3Z,5E)-5-cyclohexa-2,4-dien-1-ylidenepenta-1,3-dien-2-yl]-4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazine |
| SMILES | C=C(/C=C\C=C1\C=CC=CC1)c1nc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)nc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)n1 |
| InChI | InChI=1S/C44H37N3/c1-28(14-13-17-29-15-7-6-8-16-29)40-45-41(30-22-24-34-32-18-9-11-20-36(32)43(2,3)38(34)26-30)47-42(46-40)31-23-25-35-33-19-10-12-21-37(33)44(4,5)39(35)27-31/h6-15,17-27H,1,16H2,2-5H3/b14-13-,29-17- |
| InChIKey | GZMNRGBDNQNGMF-OYCXFOIISA-N |
| XLogP | 10.83 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|