C25H20F4N6O — CID 146480438
[4-fluoro-2-(triazol-2-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 146480438) has the molecular formula C25H20F4N6O and a molecular weight of 496.47 g/mol. Its IUPAC name is [4-fluoro-2-(triazol-2-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | [4-fluoro-2-(triazol-2-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 146480438 |
| Molecular Formula | C25H20F4N6O |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [4-fluoro-2-(triazol-2-yl)phenyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CCC[C@H]2N1C(=O)c1ccc(F)cc1-n1nccn1 |
| InChI | InChI=1S/C25H20F4N6O/c1-33-24(13-9-18(27)22(29)19(28)10-13)17-12-15-3-2-4-20(23(17)32-33)34(15)25(36)16-6-5-14(26)11-21(16)35-30-7-8-31-35/h5-11,15,20H,2-4,12H2,1H3/t15-,20+/m0/s1 |
| InChIKey | SQGVYFNSRZTARU-MGPUTAFESA-N |
| XLogP | 4.52 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|