C26H21F4N5O — CID 159467122
(3-fluoro-5-pyrazol-1-ylphenyl)-[(1R,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 159467122) has the molecular formula C26H21F4N5O and a molecular weight of 495.48 g/mol. Its IUPAC name is (3-fluoro-5-pyrazol-1-ylphenyl)-[(1R,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | (3-fluoro-5-pyrazol-1-ylphenyl)-[(1R,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 159467122 |
| Molecular Formula | C26H21F4N5O |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (3-fluoro-5-pyrazol-1-ylphenyl)-[(1R,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@H]1CCC[C@H]2N1C(=O)c1cc(F)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C26H21F4N5O/c1-33-25(14-10-20(28)23(30)21(29)11-14)19-13-17-4-2-5-22(24(19)32-33)35(17)26(36)15-8-16(27)12-18(9-15)34-7-3-6-31-34/h3,6-12,17,22H,2,4-5,13H2,1H3/t17-,22-/m1/s1 |
| InChIKey | LVIGGIBAJSAOPT-VGOFRKELSA-N |
| XLogP | 5.12 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|