C24H20F3N7O — CID 146454789
[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone (PubChem CID 146454789) has the molecular formula C24H20F3N7O and a molecular weight of 479.47 g/mol. Its IUPAC name is [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone.
| Compound Name | [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 146454789 |
| Molecular Formula | C24H20F3N7O |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1ncccc1-n1nccn1 |
| InChI | InChI=1S/C24H20F3N7O/c1-32-23(13-10-16(25)20(27)17(26)11-13)15-12-14-4-2-5-18(21(15)31-32)33(14)24(35)22-19(6-3-7-28-22)34-29-8-9-30-34/h3,6-11,14,18H,2,4-5,12H2,1H3/t14-,18+/m1/s1 |
| InChIKey | MRVZBRAIYIPGHU-KDOFPFPSSA-N |
| XLogP | 3.77 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|