C25H24F2N6O2 — CID 153470511
[5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone (PubChem CID 153470511) has the molecular formula C25H24F2N6O2 and a molecular weight of 478.50 g/mol. Its IUPAC name is [5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone.
| Compound Name | [5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 153470511 |
| Molecular Formula | C25H24F2N6O2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [5-(3,5-difluoro-4-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone |
| SMILES | COc1c(F)cc(-c2c3c(nn2C)C2CCCC(C3)N2C(=O)c2nn(C)c3ncccc23)cc1F |
| InChI | InChI=1S/C25H24F2N6O2/c1-31-22(13-10-17(26)23(35-3)18(27)11-13)16-12-14-6-4-8-19(20(16)29-31)33(14)25(34)21-15-7-5-9-28-24(15)32(2)30-21/h5,7,9-11,14,19H,4,6,8,12H2,1-3H3 |
| InChIKey | MOEQCDBALMMMSC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |