C26H21F3N4O — CID 160798606
[(1R,8S)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(8-fluoroquinolin-5-yl)methanone (PubChem CID 160798606) has the molecular formula C26H21F3N4O and a molecular weight of 462.48 g/mol. Its IUPAC name is [(1R,8S)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(8-fluoroquinolin-5-yl)methanone.
| Compound Name | [(1R,8S)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(8-fluoroquinolin-5-yl)methanone |
|---|---|
| PubChem CID | 160798606 |
| Molecular Formula | C26H21F3N4O |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(1R,8S)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(8-fluoroquinolin-5-yl)methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)cc(F)c1)C[C@@H]1CCC[C@H]2N1C(=O)c1ccc(F)c2ncccc12 |
| InChI | InChI=1S/C26H21F3N4O/c1-32-25(14-10-15(27)12-16(28)11-14)20-13-17-4-2-6-22(24(20)31-32)33(17)26(34)19-7-8-21(29)23-18(19)5-3-9-30-23/h3,5,7-12,17,22H,2,4,6,13H2,1H3/t17-,22+/m0/s1 |
| InChIKey | SCTMZLBSAANCRX-HTAPYJJXSA-N |
| XLogP | 5.34 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |