C25H21ClF2N6O — CID 153470506
[2-(5-chloro-1H-1,2,4-triazol-3-yl)phenyl]-[5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 153470506) has the molecular formula C25H21ClF2N6O and a molecular weight of 494.93 g/mol. Its IUPAC name is [2-(5-chloro-1H-1,2,4-triazol-3-yl)phenyl]-[5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | [2-(5-chloro-1H-1,2,4-triazol-3-yl)phenyl]-[5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 153470506 |
| Molecular Formula | C25H21ClF2N6O |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [2-(5-chloro-1H-1,2,4-triazol-3-yl)phenyl]-[5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)cc(F)c1)CC1CCCC2N1C(=O)c1ccccc1-c1n[nH]c(Cl)n1 |
| InChI | InChI=1S/C25H21ClF2N6O/c1-33-22(13-9-14(27)11-15(28)10-13)19-12-16-5-4-8-20(21(19)32-33)34(16)24(35)18-7-3-2-6-17(18)23-29-25(26)31-30-23/h2-3,6-7,9-11,16,20H,4-5,8,12H2,1H3,(H,29,30,31) |
| InChIKey | IBICNCNPGNRPLE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |