C24H21Cl2N5O — CID 146454777
[(1S,8R)-5-(3,5-dichlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-imidazo[1,2-a]pyridin-3-ylmethanone (PubChem CID 146454777) has the molecular formula C24H21Cl2N5O and a molecular weight of 466.37 g/mol. Its IUPAC name is [(1S,8R)-5-(3,5-dichlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-imidazo[1,2-a]pyridin-3-ylmethanone.
| Compound Name | [(1S,8R)-5-(3,5-dichlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-imidazo[1,2-a]pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 146454777 |
| Molecular Formula | C24H21Cl2N5O |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [(1S,8R)-5-(3,5-dichlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-imidazo[1,2-a]pyridin-3-ylmethanone |
| SMILES | Cn1nc2c(c1-c1cc(Cl)cc(Cl)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1cnc2ccccn12 |
| InChI | InChI=1S/C24H21Cl2N5O/c1-29-23(14-9-15(25)11-16(26)10-14)18-12-17-5-4-6-19(22(18)28-29)31(17)24(32)20-13-27-21-7-2-3-8-30(20)21/h2-3,7-11,13,17,19H,4-6,12H2,1H3/t17-,19+/m1/s1 |
| InChIKey | QFWBSNZLZUPREY-MJGOQNOKSA-N |
| XLogP | 5.33 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |