C23H18F3N5O — CID 146455314
imidazo[1,2-a]pyridin-5-yl-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone (PubChem CID 146455314) has the molecular formula C23H18F3N5O and a molecular weight of 437.43 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-5-yl-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone.
| Compound Name | imidazo[1,2-a]pyridin-5-yl-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 146455314 |
| Molecular Formula | C23H18F3N5O |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | imidazo[1,2-a]pyridin-5-yl-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@H]1CC[C@@H]2N1C(=O)c1cccc2nccn12 |
| InChI | InChI=1S/C23H18F3N5O/c1-29-22(12-9-15(24)20(26)16(25)10-12)14-11-13-5-6-17(21(14)28-29)31(13)23(32)18-3-2-4-19-27-7-8-30(18)19/h2-4,7-10,13,17H,5-6,11H2,1H3/t13-,17+/m1/s1 |
| InChIKey | MQCIAWDINRJYLO-DYVFJYSZSA-N |
| XLogP | 4.05 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|