C22H17F3N6O — CID 146491793
[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone (PubChem CID 146491793) has the molecular formula C22H17F3N6O and a molecular weight of 438.41 g/mol. Its IUPAC name is [4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone.
| Compound Name | [4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone |
|---|---|
| PubChem CID | 146491793 |
| Molecular Formula | C22H17F3N6O |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-pyrazolo[1,5-a]pyrimidin-3-ylmethanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)CC1CCC2N1C(=O)c1cnn2cccnc12 |
| InChI | InChI=1S/C22H17F3N6O/c1-29-20(11-7-15(23)18(25)16(24)8-11)13-9-12-3-4-17(19(13)28-29)31(12)22(32)14-10-27-30-6-2-5-26-21(14)30/h2,5-8,10,12,17H,3-4,9H2,1H3 |
| InChIKey | OCDPXIPASMZZHI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|