C25H19F3N4O — CID 146480349
[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-quinolin-6-ylmethanone (PubChem CID 146480349) has the molecular formula C25H19F3N4O and a molecular weight of 448.45 g/mol. Its IUPAC name is [4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-quinolin-6-ylmethanone.
| Compound Name | [4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 146480349 |
| Molecular Formula | C25H19F3N4O |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-quinolin-6-ylmethanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)CC1CCC2N1C(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C25H19F3N4O/c1-31-24(15-10-18(26)22(28)19(27)11-15)17-12-16-5-7-21(23(17)30-31)32(16)25(33)14-4-6-20-13(9-14)3-2-8-29-20/h2-4,6,8-11,16,21H,5,7,12H2,1H3 |
| InChIKey | NKKBLLDDURWFLF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|