C26H23F3N6O2 — CID 146455052
(4-methoxy-5-pyrazol-1-yl-3-pyridinyl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 146455052) has the molecular formula C26H23F3N6O2 and a molecular weight of 508.50 g/mol. Its IUPAC name is (4-methoxy-5-pyrazol-1-yl-3-pyridinyl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | (4-methoxy-5-pyrazol-1-yl-3-pyridinyl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 146455052 |
| Molecular Formula | C26H23F3N6O2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (4-methoxy-5-pyrazol-1-yl-3-pyridinyl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | COc1c(C(=O)N2[C@@H]3CCC[C@H]2c2nn(C)c(-c4cc(F)c(F)c(F)c4)c2C3)cncc1-n1cccn1 |
| InChI | InChI=1S/C26H23F3N6O2/c1-33-24(14-9-18(27)22(29)19(28)10-14)16-11-15-5-3-6-20(23(16)32-33)35(15)26(36)17-12-30-13-21(25(17)37-2)34-8-4-7-31-34/h4,7-10,12-13,15,20H,3,5-6,11H2,1-2H3/t15-,20+/m1/s1 |
| InChIKey | IYMMEIPWFRVFNU-QRWLVFNGSA-N |
| XLogP | 4.39 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|