C24H24F3N5O — CID 153470461
(5-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone (PubChem CID 153470461) has the molecular formula C24H24F3N5O and a molecular weight of 455.48 g/mol. Its IUPAC name is (5-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone.
| Compound Name | (5-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 153470461 |
| Molecular Formula | C24H24F3N5O |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (5-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)-[4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
| SMILES | CC1CCCc2ncc(C(=O)N3C4CCC3c3nn(C)c(-c5cc(F)c(F)c(F)c5)c3C4)n21 |
| InChI | InChI=1S/C24H24F3N5O/c1-12-4-3-5-20-28-11-19(31(12)20)24(33)32-14-6-7-18(32)22-15(10-14)23(30(2)29-22)13-8-16(25)21(27)17(26)9-13/h8-9,11-12,14,18H,3-7,10H2,1-2H3 |
| InChIKey | DMVZFWPNNGYVBD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|