C23H22F3N5O — CID 146455312
[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methanone (PubChem CID 146455312) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methanone.
| Compound Name | [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 146455312 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@H]1CC[C@@H]2N1C(=O)c1cnc2n1CCCC2 |
| InChI | InChI=1S/C23H22F3N5O/c1-29-22(12-8-15(24)20(26)16(25)9-12)14-10-13-5-6-17(21(14)28-29)31(13)23(32)18-11-27-19-4-2-3-7-30(18)19/h8-9,11,13,17H,2-7,10H2,1H3/t13-,17+/m1/s1 |
| InChIKey | ULVDVVLHPBTPFL-DYVFJYSZSA-N |
| XLogP | 3.94 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|