C23H23F2N5O — CID 146455206
(5-cyclopropyl-1-methylpyrazol-4-yl)-[(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone (PubChem CID 146455206) has the molecular formula C23H23F2N5O and a molecular weight of 423.47 g/mol. Its IUPAC name is (5-cyclopropyl-1-methylpyrazol-4-yl)-[(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone.
| Compound Name | (5-cyclopropyl-1-methylpyrazol-4-yl)-[(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 146455206 |
| Molecular Formula | C23H23F2N5O |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (5-cyclopropyl-1-methylpyrazol-4-yl)-[(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,11-triazatricyclo[6.2.1.02,6]undeca-2,5-dien-11-yl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)cc(F)c1)C[C@H]1CC[C@@H]2N1C(=O)c1cnn(C)c1C1CC1 |
| InChI | InChI=1S/C23H23F2N5O/c1-28-21(12-3-4-12)18(11-26-28)23(31)30-16-5-6-19(30)20-17(10-16)22(29(2)27-20)13-7-14(24)9-15(25)8-13/h7-9,11-12,16,19H,3-6,10H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | SAAWQIULIAGEHF-APWZRJJASA-N |
| XLogP | 3.88 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |