C25H20F3N7O — CID 170125963
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone (PubChem CID 170125963) has the molecular formula C25H20F3N7O and a molecular weight of 491.48 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 170125963 |
| Molecular Formula | C25H20F3N7O |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]-[3-(triazol-2-yl)-2-pyridinyl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CCC3(C(=O)c4ncccc4-n4nccn4)C[C@H]2N13 |
| InChI | InChI=1S/C25H20F3N7O/c1-33-23(13-9-16(26)20(28)17(27)10-13)15-11-14-4-5-25(12-19(34(14)25)21(15)32-33)24(36)22-18(3-2-6-29-22)35-30-7-8-31-35/h2-3,6-10,14,19H,4-5,11-12H2,1H3/t14-,19+,25?/m0/s1 |
| InChIKey | VUDJZURTAAUBGN-VFMRZZMPSA-N |
| XLogP | 3.57 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|