C26H22F3N7O — CID 170125971
[6-methyl-4-(triazol-2-yl)-2-pyridinyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]methanone (PubChem CID 170125971) has the molecular formula C26H22F3N7O and a molecular weight of 505.50 g/mol. Its IUPAC name is [6-methyl-4-(triazol-2-yl)-2-pyridinyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]methanone.
| Compound Name | [6-methyl-4-(triazol-2-yl)-2-pyridinyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]methanone |
|---|---|
| PubChem CID | 170125971 |
| Molecular Formula | C26H22F3N7O |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | [6-methyl-4-(triazol-2-yl)-2-pyridinyl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,13-triazatetracyclo[6.4.1.02,6.011,13]trideca-2,5-dien-11-yl]methanone |
| SMILES | Cc1cc(-n2nccn2)cc(C(=O)C23CC[C@H]4Cc5c(nn(C)c5-c5cc(F)c(F)c(F)c5)[C@@H](C2)N43)n1 |
| InChI | InChI=1S/C26H22F3N7O/c1-13-7-16(36-30-5-6-31-36)11-20(32-13)25(37)26-4-3-15-10-17-23(21(12-26)35(15)26)33-34(2)24(17)14-8-18(27)22(29)19(28)9-14/h5-9,11,15,21H,3-4,10,12H2,1-2H3/t15-,21+,26?/m0/s1 |
| InChIKey | HPQXHNVPUNCXEF-ABQCGAOJSA-N |
| XLogP | 3.88 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|