C19H19N3O4 — CID 146482640
N-[4-[[(1,3-dioxoisoindol-2-yl)amino]-hydroxymethyl]phenyl]-2-methylpropanamide (PubChem CID 146482640) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[4-[[(1,3-dioxoisoindol-2-yl)amino]-hydroxymethyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[(1,3-dioxoisoindol-2-yl)amino]-hydroxymethyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 146482640 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[4-[[(1,3-dioxoisoindol-2-yl)amino]-hydroxymethyl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(O)NN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-11(2)16(23)20-13-9-7-12(8-10-13)17(24)21-22-18(25)14-5-3-4-6-15(14)19(22)26/h3-11,17,21,24H,1-2H3,(H,20,23) |
| InChIKey | ZNDSLPXNOCAXIV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|