C27H24N8O2 — CID 146482917
1-[3-[4-amino-3-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 146482917) has the molecular formula C27H24N8O2 and a molecular weight of 492.54 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146482917 |
| Molecular Formula | C27H24N8O2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 1-[3-[4-amino-3-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(-c4noc(-c5ccccc5)n4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C27H24N8O2/c1-2-21(36)34-14-6-9-20(15-34)35-26-22(24(28)29-16-30-26)23(32-35)17-10-12-18(13-11-17)25-31-27(37-33-25)19-7-4-3-5-8-19/h2-5,7-8,10-13,16,20H,1,6,9,14-15H2,(H2,28,29,30) |
| InChIKey | BDXHFRALNYKXTO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|