C5H3F3N2O4S — CID 146482957
(6-oxo-1H-pyrimidin-4-yl) trifluoromethanesulfonate (PubChem CID 146482957) has the molecular formula C5H3F3N2O4S and a molecular weight of 244.15 g/mol. Its IUPAC name is (6-oxo-1H-pyrimidin-4-yl) trifluoromethanesulfonate.
| Compound Name | (6-oxo-1H-pyrimidin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146482957 |
| Molecular Formula | C5H3F3N2O4S |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | (6-oxo-1H-pyrimidin-4-yl) trifluoromethanesulfonate |
| SMILES | O=c1cc(OS(=O)(=O)C(F)(F)F)nc[nH]1 |
| InChI | InChI=1S/C5H3F3N2O4S/c6-5(7,8)15(12,13)14-4-1-3(11)9-2-10-4/h1-2H,(H,9,10,11) |
| InChIKey | GKQLBHPFMJEDQQ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|