C15H18ClN5O2 — CID 146485662
[(4S)-1-(6-chloropyrido[2,3-b]pyrazin-2-yl)azepan-4-yl]-methylcarbamic acid (PubChem CID 146485662) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is [(4S)-1-(6-chloropyrido[2,3-b]pyrazin-2-yl)azepan-4-yl]-methylcarbamic acid.
| Compound Name | [(4S)-1-(6-chloropyrido[2,3-b]pyrazin-2-yl)azepan-4-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 146485662 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [(4S)-1-(6-chloropyrido[2,3-b]pyrazin-2-yl)azepan-4-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)[C@H]1CCCN(c2cnc3nc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C15H18ClN5O2/c1-20(15(22)23)10-3-2-7-21(8-6-10)13-9-17-14-11(18-13)4-5-12(16)19-14/h4-5,9-10H,2-3,6-8H2,1H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | GXYNFMYTXFBXCE-JTQLQIEISA-N |
| XLogP | 2.65 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|