About [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid
[1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid (PubChem CID 87561204) has the molecular formula C13H15ClN4O3
and a molecular weight of 310.74 g/mol. Its IUPAC name is [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid |
| PubChem CID | 87561204 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1CCN(c2nc(Cl)nc3ccoc23)CC1 |
| InChI | InChI=1S/C13H15ClN4O3/c1-17(13(19)20)8-2-5-18(6-3-8)11-10-9(4-7-21-10)15-12(14)16-11/h4,7-8H,2-3,5-6H2,1H3,(H,19,20) |
| InChIKey | BAZQEYSRLBNORX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid?
The IUPAC name of [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid (CID 87561204) is [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid.
What is the SMILES notation for [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid?
The canonical SMILES for [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid is CN(C(=O)O)C1CCN(c2nc(Cl)nc3ccoc23)CC1.
What is the InChIKey of [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid?
The InChIKey is BAZQEYSRLBNORX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN4O3/c1-17(13(19)20)8-2-5-18(6-3-8)11-10-9(4-7-21-10)15-12(14)16-11/h4,7-8H,2-3,5-6H2,1H3,(H,19,20).
What are the key properties of [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid?
[1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid has a molecular weight of 310.74 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-chlorofuro[3,2-d]pyrimidin-4-yl)piperidin-4-yl]-methylcarbamic acid is sourced from PubChem (CID 87561204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).