C21H18FN3O2 — CID 146486331
(E)-3-[6-propan-2-yl-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)-1H-pyrrolo[2,3-f]indazol-7-yl]prop-2-enoic acid (PubChem CID 146486331) has the molecular formula C21H18FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is (E)-3-[6-propan-2-yl-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)-1H-pyrrolo[2,3-f]indazol-7-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-propan-2-yl-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)-1H-pyrrolo[2,3-f]indazol-7-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146486331 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (E)-3-[6-propan-2-yl-5-(2,3,5,6-tetradeuterio-4-fluorophenyl)-1H-pyrrolo[2,3-f]indazol-7-yl]prop-2-enoic acid |
| SMILES | [2H]c1c([2H])c(-n2c(C(C)C)c(/C=C/C(=O)O)c3cc4[nH]ncc4cc32)c([2H])c([2H])c1F |
| InChI | InChI=1S/C21H18FN3O2/c1-12(2)21-16(7-8-20(26)27)17-10-18-13(11-23-24-18)9-19(17)25(21)15-5-3-14(22)4-6-15/h3-12H,1-2H3,(H,23,24)(H,26,27)/b8-7+/i3D,4D,5D,6D |
| InChIKey | MIHHIFDWOAOQHX-PYTYSWDNSA-N |
| XLogP | 4.87 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|