C21H19F2NO3 — CID 156877388
(E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid (PubChem CID 156877388) has the molecular formula C21H19F2NO3 and a molecular weight of 371.38 g/mol. Its IUPAC name is (E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156877388 |
| Molecular Formula | C21H19F2NO3 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid |
| SMILES | Cc1cc(-n2c(C(C)C)c(/C=C/C(=O)O)c3cc(O)c(F)cc32)ccc1F |
| InChI | InChI=1S/C21H19F2NO3/c1-11(2)21-14(5-7-20(26)27)15-9-19(25)17(23)10-18(15)24(21)13-4-6-16(22)12(3)8-13/h4-11,25H,1-3H3,(H,26,27)/b7-5+ |
| InChIKey | YHFDQEVCXSRPKM-FNORWQNLSA-N |
| XLogP | 5.14 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|