C22H21F2NO3 — CID 156877547
(E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-methoxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid (PubChem CID 156877547) has the molecular formula C22H21F2NO3 and a molecular weight of 385.41 g/mol. Its IUPAC name is (E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-methoxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-methoxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156877547 |
| Molecular Formula | C22H21F2NO3 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (E)-3-[6-fluoro-1-(4-fluoro-3-methylphenyl)-5-methoxy-2-propan-2-ylindol-3-yl]prop-2-enoic acid |
| SMILES | COc1cc2c(/C=C/C(=O)O)c(C(C)C)n(-c3ccc(F)c(C)c3)c2cc1F |
| InChI | InChI=1S/C22H21F2NO3/c1-12(2)22-15(6-8-21(26)27)16-10-20(28-4)18(24)11-19(16)25(22)14-5-7-17(23)13(3)9-14/h5-12H,1-4H3,(H,26,27)/b8-6+ |
| InChIKey | DTLMPVXSHKZQTR-SOFGYWHQSA-N |
| XLogP | 5.45 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|