C18H16FN5O — CID 146488505
cis-(1S,2S)-N-[8-amino-6-(3-methyl-4-pyridinyl)cinnolin-3-yl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 146488505) has the molecular formula C18H16FN5O and a molecular weight of 337.36 g/mol. Its IUPAC name is cis-(1S,2S)-N-[8-amino-6-(3-methyl-4-pyridinyl)cinnolin-3-yl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[8-amino-6-(3-methyl-4-pyridinyl)cinnolin-3-yl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 146488505 |
| Molecular Formula | C18H16FN5O |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | cis-(1S,2S)-N-[8-amino-6-(3-methyl-4-pyridinyl)cinnolin-3-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | Cc1cnccc1-c1cc(N)c2nnc(NC(=O)[C@@H]3C[C@@H]3F)cc2c1 |
| InChI | InChI=1S/C18H16FN5O/c1-9-8-21-3-2-12(9)10-4-11-6-16(22-18(25)13-7-14(13)19)23-24-17(11)15(20)5-10/h2-6,8,13-14H,7,20H2,1H3,(H,22,23,25)/t13-,14+/m1/s1 |
| InChIKey | KCWZHSJLDADYKM-KGLIPLIRSA-N |
| XLogP | 2.88 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|