C19H30N2O6 — CID 146488963
[1-[ethyl-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]carbamoyl]oxy-2-methylpropyl] 3-amino-2-methylpropanoate (PubChem CID 146488963) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is [1-[ethyl-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]carbamoyl]oxy-2-methylpropyl] 3-amino-2-methylpropanoate.
| Compound Name | [1-[ethyl-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]carbamoyl]oxy-2-methylpropyl] 3-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 146488963 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [1-[ethyl-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]carbamoyl]oxy-2-methylpropyl] 3-amino-2-methylpropanoate |
| SMILES | CCN(CC(O)c1cccc(O)c1)C(=O)OC(OC(=O)C(C)CN)C(C)C |
| InChI | InChI=1S/C19H30N2O6/c1-5-21(11-16(23)14-7-6-8-15(22)9-14)19(25)27-18(12(2)3)26-17(24)13(4)10-20/h6-9,12-13,16,18,22-23H,5,10-11,20H2,1-4H3 |
| InChIKey | MSQIZDYTVCWQDX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|