C11H21F3O3 — CID 146489947
2-ethyl-2-(2,2,2-trifluoroethoxymethyl)hexane-1,4-diol (PubChem CID 146489947) has the molecular formula C11H21F3O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-ethyl-2-(2,2,2-trifluoroethoxymethyl)hexane-1,4-diol.
| Compound Name | 2-ethyl-2-(2,2,2-trifluoroethoxymethyl)hexane-1,4-diol |
|---|---|
| PubChem CID | 146489947 |
| Molecular Formula | C11H21F3O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-ethyl-2-(2,2,2-trifluoroethoxymethyl)hexane-1,4-diol |
| SMILES | CCC(O)CC(CC)(CO)COCC(F)(F)F |
| InChI | InChI=1S/C11H21F3O3/c1-3-9(16)5-10(4-2,6-15)7-17-8-11(12,13)14/h9,15-16H,3-8H2,1-2H3 |
| InChIKey | WQOHZXNPALXGCB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |