C21H29NO5S — CID 14649069
4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butyl 4-methylbenzenesulfonate (PubChem CID 14649069) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is 4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butyl 4-methylbenzenesulfonate.
| Compound Name | 4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14649069 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCN2C(=O)C3CCC(C)(C2=O)C3(C)C)cc1 |
| InChI | InChI=1S/C21H29NO5S/c1-15-7-9-16(10-8-15)28(25,26)27-14-6-5-13-22-18(23)17-11-12-21(4,19(22)24)20(17,2)3/h7-10,17H,5-6,11-14H2,1-4H3 |
| InChIKey | UBQOKGDSKOVJSB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|