C16H21FN2O — CID 146492058
(2Z)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]penta-2,4-dien-2-ol (PubChem CID 146492058) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is (2Z)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]penta-2,4-dien-2-ol.
| Compound Name | (2Z)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]penta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 146492058 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (2Z)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]penta-2,4-dien-2-ol |
| SMILES | C=C/C=C(\O)CN1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H21FN2O/c1-2-3-16(20)13-19-10-8-18(9-11-19)12-14-4-6-15(17)7-5-14/h2-7,20H,1,8-13H2/b16-3- |
| InChIKey | UXAIBAVDOSIVEV-XFQLMFQHSA-N |
| XLogP | 2.57 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|