C25H19Cl2N3O3S — CID 146493691
ethyl 4,6-dichloro-5-[(6-cyano-4-methyl-1-phenylsulfanylindol-2-yl)-hydroxymethyl]pyridine-3-carboxylate (PubChem CID 146493691) has the molecular formula C25H19Cl2N3O3S and a molecular weight of 512.42 g/mol. Its IUPAC name is ethyl 4,6-dichloro-5-[(6-cyano-4-methyl-1-phenylsulfanylindol-2-yl)-hydroxymethyl]pyridine-3-carboxylate.
| Compound Name | ethyl 4,6-dichloro-5-[(6-cyano-4-methyl-1-phenylsulfanylindol-2-yl)-hydroxymethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146493691 |
| Molecular Formula | C25H19Cl2N3O3S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | ethyl 4,6-dichloro-5-[(6-cyano-4-methyl-1-phenylsulfanylindol-2-yl)-hydroxymethyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c(C(O)c2cc3c(C)cc(C#N)cc3n2Sc2ccccc2)c1Cl |
| InChI | InChI=1S/C25H19Cl2N3O3S/c1-3-33-25(32)18-13-29-24(27)21(22(18)26)23(31)20-11-17-14(2)9-15(12-28)10-19(17)30(20)34-16-7-5-4-6-8-16/h4-11,13,23,31H,3H2,1-2H3 |
| InChIKey | FRMJCSNWMCDZIL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|